C19H20F3N3O — CID 58700362
(4aS,9bR)-5-methyl-8-(pyridin-2-ylmethoxy)-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 58700362) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is (4aS,9bR)-5-methyl-8-(pyridin-2-ylmethoxy)-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aS,9bR)-5-methyl-8-(pyridin-2-ylmethoxy)-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 58700362 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (4aS,9bR)-5-methyl-8-(pyridin-2-ylmethoxy)-6-(trifluoromethyl)-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1c2c(cc(OCc3ccccn3)cc2C(F)(F)F)[C@@H]2CNCC[C@@H]21 |
| InChI | InChI=1S/C19H20F3N3O/c1-25-17-5-7-23-10-15(17)14-8-13(9-16(18(14)25)19(20,21)22)26-11-12-4-2-3-6-24-12/h2-4,6,8-9,15,17,23H,5,7,10-11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | UOAGAYQQXYPMNJ-RDJZCZTQSA-N |
| XLogP | 3.57 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|