C20H23N5O — CID 58700376
(4aS,9bR)-8-[(2-ethoxy-3-pyridinyl)amino]-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile (PubChem CID 58700376) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is (4aS,9bR)-8-[(2-ethoxy-3-pyridinyl)amino]-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile.
| Compound Name | (4aS,9bR)-8-[(2-ethoxy-3-pyridinyl)amino]-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile |
|---|---|
| PubChem CID | 58700376 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (4aS,9bR)-8-[(2-ethoxy-3-pyridinyl)amino]-5-methyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole-6-carbonitrile |
| SMILES | CCOc1ncccc1Nc1cc(C#N)c2c(c1)[C@@H]1CNCC[C@@H]1N2C |
| InChI | InChI=1S/C20H23N5O/c1-3-26-20-17(5-4-7-23-20)24-14-9-13(11-21)19-15(10-14)16-12-22-8-6-18(16)25(19)2/h4-5,7,9-10,16,18,22,24H,3,6,8,12H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | MZVJQEMYLYMJBN-WMZOPIPTSA-N |
| XLogP | 2.99 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |