C25H34O8S — CID 58700854
methyl (7R,10R,11R,13S)-10,13-dimethyl-11-methylsulfonyloxy-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate (PubChem CID 58700854) has the molecular formula C25H34O8S and a molecular weight of 494.61 g/mol. Its IUPAC name is methyl (7R,10R,11R,13S)-10,13-dimethyl-11-methylsulfonyloxy-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate.
| Compound Name | methyl (7R,10R,11R,13S)-10,13-dimethyl-11-methylsulfonyloxy-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
|---|---|
| PubChem CID | 58700854 |
| Molecular Formula | C25H34O8S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | methyl (7R,10R,11R,13S)-10,13-dimethyl-11-methylsulfonyloxy-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-carboxylate |
| SMILES | COC(=O)C1CC2=CC(=O)CC[C@]2(C)C2C(OS(C)(=O)=O)C[C@@]3(C)C(CCC34CCC(=O)O4)C12 |
| InChI | InChI=1S/C25H34O8S/c1-23-8-5-15(26)11-14(23)12-16(22(28)31-3)20-17-6-9-25(10-7-19(27)32-25)24(17,2)13-18(21(20)23)33-34(4,29)30/h11,16-18,20-21H,5-10,12-13H2,1-4H3/t16?,17?,18?,20?,21?,23-,24-,25?/m0/s1 |
| InChIKey | CKLAKMSTXODAGW-ZUWZTHAISA-N |
| XLogP | 2.95 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|