C23H21N2OS+ — CID 58700960
N,N-dimethyl-4-(14-oxa-17-thia-11-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaen-15-ylidenemethyl)aniline (PubChem CID 58700960) has the molecular formula C23H21N2OS+ and a molecular weight of 373.50 g/mol. Its IUPAC name is N,N-dimethyl-4-(14-oxa-17-thia-11-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaen-15-ylidenemethyl)aniline.
| Compound Name | N,N-dimethyl-4-(14-oxa-17-thia-11-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaen-15-ylidenemethyl)aniline |
|---|---|
| PubChem CID | 58700960 |
| Molecular Formula | C23H21N2OS+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N,N-dimethyl-4-(14-oxa-17-thia-11-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11(16)-hexaen-15-ylidenemethyl)aniline |
| SMILES | CN(C)c1ccc(C=C2OCC[n+]3c2sc2c4ccccc4ccc23)cc1 |
| InChI | InChI=1S/C23H21N2OS/c1-24(2)18-10-7-16(8-11-18)15-21-23-25(13-14-26-21)20-12-9-17-5-3-4-6-19(17)22(20)27-23/h3-12,15H,13-14H2,1-2H3/q+1 |
| InChIKey | JAICLUCJIWENMK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|