C23H26N3S+ — CID 58701071
3-ethyl-2-[2-(16-ethyl-16-aza-11-azoniatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-14-ylidene)ethylidene]-1,3-thiazolidine (PubChem CID 58701071) has the molecular formula C23H26N3S+ and a molecular weight of 376.55 g/mol. Its IUPAC name is 3-ethyl-2-[2-(16-ethyl-16-aza-11-azoniatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-14-ylidene)ethylidene]-1,3-thiazolidine.
| Compound Name | 3-ethyl-2-[2-(16-ethyl-16-aza-11-azoniatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-14-ylidene)ethylidene]-1,3-thiazolidine |
|---|---|
| PubChem CID | 58701071 |
| Molecular Formula | C23H26N3S+ |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-ethyl-2-[2-(16-ethyl-16-aza-11-azoniatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-14-ylidene)ethylidene]-1,3-thiazolidine |
| SMILES | CCN1CCSC1=CC=C1CC[n+]2c1n(CC)c1cc3ccccc3cc12 |
| InChI | InChI=1S/C23H26N3S/c1-3-24-13-14-27-22(24)10-9-17-11-12-26-21-16-19-8-6-5-7-18(19)15-20(21)25(4-2)23(17)26/h5-10,15-16H,3-4,11-14H2,1-2H3/q+1 |
| InChIKey | YOAIWYBZRGSNDF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|