About CID 58701447
CID 58701447 (PubChem CID 58701447) has the molecular formula C18H34B2O11P2S
and a molecular weight of 542.10 g/mol.
Molecular Properties
| Compound Name | CID 58701447 |
| PubChem CID | 58701447 |
| Molecular Formula | C18H34B2O11P2S |
| Molecular Weight | 542.10 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC(OC(C)C)[C@@H](COP(=O)(OC)OCSP(=O)(O)OC2C[C@H]([B])O[C@@H]2COC(C)C)O1 |
| InChI | InChI=1S/C18H34B2O11P2S/c1-11(2)25-8-15-14(7-18(20)29-15)31-32(21,22)34-10-27-33(23,24-5)26-9-16-13(28-12(3)4)6-17(19)30-16/h11-18H,6-10H2,1-5H3,(H,21,22)/t13?,14?,15-,16-,17-,18-,33?/m1/s1 |
| InChIKey | YFZJODVMMCQSMY-VLGNILSOSA-N |
| XLogP | 2.74 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.10 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 58701447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58701447?
The IUPAC name of CID 58701447 (CID 58701447) is not available.
What is the SMILES notation for CID 58701447?
The canonical SMILES for CID 58701447 is [B][C@H]1CC(OC(C)C)[C@@H](COP(=O)(OC)OCSP(=O)(O)OC2C[C@H]([B])O[C@@H]2COC(C)C)O1.
What is the InChIKey of CID 58701447?
The InChIKey is YFZJODVMMCQSMY-VLGNILSOSA-N. The full InChI is InChI=1S/C18H34B2O11P2S/c1-11(2)25-8-15-14(7-18(20)29-15)31-32(21,22)34-10-27-33(23,24-5)26-9-16-13(28-12(3)4)6-17(19)30-16/h11-18H,6-10H2,1-5H3,(H,21,22)/t13?,14?,15-,16-,17-,18-,33?/m1/s1.
What are the key properties of CID 58701447?
CID 58701447 has a molecular weight of 542.10 g/mol, XLogP of 2.74, 15 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58701447 is sourced from PubChem (CID 58701447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).