About 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile
2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile (PubChem CID 58701458) has the molecular formula C20H36N4
and a molecular weight of 332.54 g/mol. Its IUPAC name is 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile.
Molecular Properties
| Compound Name | 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile |
| PubChem CID | 58701458 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile |
| SMILES | [C-]#[N+]C(CC(C)C)(CC(C)C)/N=N/C(C#N)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C20H36N4/c1-15(2)10-19(14-21,11-16(3)4)23-24-20(22-9,12-17(5)6)13-18(7)8/h15-18H,10-13H2,1-8H3/b24-23+ |
| InChIKey | KHCNEVFVPJPEBP-WCWDXBQESA-N |
| XLogP | 6.50 |
| TPSA | 52.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile?
The IUPAC name of 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile (CID 58701458) is 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile.
What is the SMILES notation for 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile?
The canonical SMILES for 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile is [C-]#[N+]C(CC(C)C)(CC(C)C)/N=N/C(C#N)(CC(C)C)CC(C)C.
What is the InChIKey of 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile?
The InChIKey is KHCNEVFVPJPEBP-WCWDXBQESA-N. The full InChI is InChI=1S/C20H36N4/c1-15(2)10-19(14-21,11-16(3)4)23-24-20(22-9,12-17(5)6)13-18(7)8/h15-18H,10-13H2,1-8H3/b24-23+.
What are the key properties of 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile?
2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile has a molecular weight of 332.54 g/mol, XLogP of 6.50, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-isocyano-2,6-dimethylheptan-4-yl)diazenyl]-4-methyl-2-(2-methylpropyl)pentanenitrile is sourced from PubChem (CID 58701458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).