C27H50Cl2N2SiTi-2 — CID 58701459
tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,5a,6,6a,6b,7,8,9,10,10a,11,11a,12,12a,12b-octadecahydro-1H-indeno[1,2-b]carbazol-11-yl)silyl]azanide;carbanide;dichlorotitanium (PubChem CID 58701459) has the molecular formula C27H50Cl2N2SiTi-2 and a molecular weight of 549.57 g/mol. Its IUPAC name is tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,5a,6,6a,6b,7,8,9,10,10a,11,11a,12,12a,12b-octadecahydro-1H-indeno[1,2-b]carbazol-11-yl)silyl]azanide;carbanide;dichlorotitanium.
| Compound Name | tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,5a,6,6a,6b,7,8,9,10,10a,11,11a,12,12a,12b-octadecahydro-1H-indeno[1,2-b]carbazol-11-yl)silyl]azanide;carbanide;dichlorotitanium |
|---|---|
| PubChem CID | 58701459 |
| Molecular Formula | C27H50Cl2N2SiTi-2 |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | tert-butyl-[dimethyl-(5-methyl-2,3,4,4a,5a,6,6a,6b,7,8,9,10,10a,11,11a,12,12a,12b-octadecahydro-1H-indeno[1,2-b]carbazol-11-yl)silyl]azanide;carbanide;dichlorotitanium |
| SMILES | CN1C2CCCCC2C2CC3C(CC21)C1CCCCC1C3[Si](C)(C)[N-]C(C)(C)C.Cl[Ti]Cl.[CH3-] |
| InChI | InChI=1S/C26H47N2Si.CH3.2ClH.Ti/c1-26(2,3)27-29(5,6)25-19-13-8-7-11-17(19)20-16-24-21(15-22(20)25)18-12-9-10-14-23(18)28(24)4;;;;/h17-25H,7-16H2,1-6H3;1H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | FTMPSBYBAICADM-UHFFFAOYSA-L |
| XLogP | 8.90 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|