About 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium
3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium (PubChem CID 58701790) has the molecular formula C10H17N2O3Y-
and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium.
Molecular Properties
| Compound Name | 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium |
| PubChem CID | 58701790 |
| Molecular Formula | C10H17N2O3Y- |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium |
| SMILES | NC[CH-]C(=O)N1CCC2(CC1)OCCO2.[Y] |
| InChI | InChI=1S/C10H17N2O3.Y/c11-4-1-9(13)12-5-2-10(3-6-12)14-7-8-15-10;/h1H,2-8,11H2;/q-1; |
| InChIKey | OAOPWNHROMRNGZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium?
The IUPAC name of 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium (CID 58701790) is 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium.
What is the SMILES notation for 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium?
The canonical SMILES for 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium is NC[CH-]C(=O)N1CCC2(CC1)OCCO2.[Y].
What is the InChIKey of 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium?
The InChIKey is OAOPWNHROMRNGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2O3.Y/c11-4-1-9(13)12-5-2-10(3-6-12)14-7-8-15-10;/h1H,2-8,11H2;/q-1;.
What are the key properties of 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium?
3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium has a molecular weight of 302.16 g/mol, XLogP of -0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)propan-1-one;yttrium is sourced from PubChem (CID 58701790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).