C21H24F3N3O4S — CID 58702874
[6-ethyl-5-[1-[(2S)-1-methoxypropan-2-yl]-3,6-dimethylpyrrolo[3,2-b]pyridin-5-yl]-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 58702874) has the molecular formula C21H24F3N3O4S and a molecular weight of 471.50 g/mol. Its IUPAC name is [6-ethyl-5-[1-[(2S)-1-methoxypropan-2-yl]-3,6-dimethylpyrrolo[3,2-b]pyridin-5-yl]-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [6-ethyl-5-[1-[(2S)-1-methoxypropan-2-yl]-3,6-dimethylpyrrolo[3,2-b]pyridin-5-yl]-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58702874 |
| Molecular Formula | C21H24F3N3O4S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [6-ethyl-5-[1-[(2S)-1-methoxypropan-2-yl]-3,6-dimethylpyrrolo[3,2-b]pyridin-5-yl]-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | CCc1nc(OS(=O)(=O)C(F)(F)F)ccc1-c1nc2c(C)cn([C@@H](C)COC)c2cc1C |
| InChI | InChI=1S/C21H24F3N3O4S/c1-6-16-15(7-8-18(25-16)31-32(28,29)21(22,23)24)19-12(2)9-17-20(26-19)13(3)10-27(17)14(4)11-30-5/h7-10,14H,6,11H2,1-5H3/t14-/m0/s1 |
| InChIKey | KWWUFXCSCREQRQ-AWEZNQCLSA-N |
| XLogP | 4.71 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|