About 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide
3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide (PubChem CID 58703332) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide.
Molecular Properties
| Compound Name | 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide |
| PubChem CID | 58703332 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide |
| SMILES | CN1CC(CNCCC(=O)NOC2CCCCO2)c2ccccc21 |
| InChI | InChI=1S/C18H27N3O3/c1-21-13-14(15-6-2-3-7-16(15)21)12-19-10-9-17(22)20-24-18-8-4-5-11-23-18/h2-3,6-7,14,18-19H,4-5,8-13H2,1H3,(H,20,22) |
| InChIKey | LFHSROUCTAZPCG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide?
The IUPAC name of 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide (CID 58703332) is 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide.
What is the SMILES notation for 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide?
The canonical SMILES for 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide is CN1CC(CNCCC(=O)NOC2CCCCO2)c2ccccc21.
What is the InChIKey of 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide?
The InChIKey is LFHSROUCTAZPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-21-13-14(15-6-2-3-7-16(15)21)12-19-10-9-17(22)20-24-18-8-4-5-11-23-18/h2-3,6-7,14,18-19H,4-5,8-13H2,1H3,(H,20,22).
What are the key properties of 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide?
3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide has a molecular weight of 333.43 g/mol, XLogP of 1.77, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methyl-2,3-dihydroindol-3-yl)methylamino]-N-(oxan-2-yloxy)propanamide is sourced from PubChem (CID 58703332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).