C29H32IrN2OS-2 — CID 58703835
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;N-hexyl-1-(2-methanidyloxy-3,5-dimethylphenyl)methanimine;iridium (PubChem CID 58703835) has the molecular formula C29H32IrN2OS-2 and a molecular weight of 648.87 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;N-hexyl-1-(2-methanidyloxy-3,5-dimethylphenyl)methanimine;iridium.
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;N-hexyl-1-(2-methanidyloxy-3,5-dimethylphenyl)methanimine;iridium |
|---|---|
| PubChem CID | 58703835 |
| Molecular Formula | C29H32IrN2OS-2 |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;N-hexyl-1-(2-methanidyloxy-3,5-dimethylphenyl)methanimine;iridium |
| SMILES | [CH2-]Oc1c(C)cc(C)cc1/C=N/CCCCCC.[Ir].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C16H24NO.C13H8NS.Ir/c1-5-6-7-8-9-17-12-15-11-13(2)10-14(3)16(15)18-4;1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;/h10-12H,4-9H2,1-3H3;1-8H;/q2*-1;/b17-12+;; |
| InChIKey | GJKFYZMFSQQKGV-CWQUOYFRSA-N |
| XLogP | 8.23 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|