C26H36F6N3O5P — CID 58703924
N-[4-[(3,3-dimethyl-2-methylidene-1-propylindol-5-yl)-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]oxybutyl]-2,2,2-trifluoroacetamide (PubChem CID 58703924) has the molecular formula C26H36F6N3O5P and a molecular weight of 615.55 g/mol. Its IUPAC name is N-[4-[(3,3-dimethyl-2-methylidene-1-propylindol-5-yl)-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]oxybutyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(3,3-dimethyl-2-methylidene-1-propylindol-5-yl)-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]oxybutyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 58703924 |
| Molecular Formula | C26H36F6N3O5P |
| Molecular Weight | 615.55 g/mol |
| Exact Mass | 615.23 |
| IUPAC Name | N-[4-[(3,3-dimethyl-2-methylidene-1-propylindol-5-yl)-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]oxybutyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C1N(CCC)c2ccc(P(=O)(OCCCCNC(=O)C(F)(F)F)OCCCCNC(=O)C(F)(F)F)cc2C1(C)C |
| InChI | InChI=1S/C26H36F6N3O5P/c1-5-14-35-18(2)24(3,4)20-17-19(10-11-21(20)35)41(38,39-15-8-6-12-33-22(36)25(27,28)29)40-16-9-7-13-34-23(37)26(30,31)32/h10-11,17H,2,5-9,12-16H2,1,3-4H3,(H,33,36)(H,34,37) |
| InChIKey | ZIVFHYFBLBLVKT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|