About 2-anthracen-9-yl-N,N-dimethylethanethioamide
2-anthracen-9-yl-N,N-dimethylethanethioamide (PubChem CID 58704033) has the molecular formula C18H17NS
and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-anthracen-9-yl-N,N-dimethylethanethioamide.
Molecular Properties
| Compound Name | 2-anthracen-9-yl-N,N-dimethylethanethioamide |
| PubChem CID | 58704033 |
| Molecular Formula | C18H17NS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-anthracen-9-yl-N,N-dimethylethanethioamide |
| SMILES | CN(C)C(=S)Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C18H17NS/c1-19(2)18(20)12-17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17/h3-11H,12H2,1-2H3 |
| InChIKey | WYEROUJEDWTYIM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-anthracen-9-yl-N,N-dimethylethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anthracen-9-yl-N,N-dimethylethanethioamide?
The IUPAC name of 2-anthracen-9-yl-N,N-dimethylethanethioamide (CID 58704033) is 2-anthracen-9-yl-N,N-dimethylethanethioamide.
What is the SMILES notation for 2-anthracen-9-yl-N,N-dimethylethanethioamide?
The canonical SMILES for 2-anthracen-9-yl-N,N-dimethylethanethioamide is CN(C)C(=S)Cc1c2ccccc2cc2ccccc12.
What is the InChIKey of 2-anthracen-9-yl-N,N-dimethylethanethioamide?
The InChIKey is WYEROUJEDWTYIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NS/c1-19(2)18(20)12-17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17/h3-11H,12H2,1-2H3.
What are the key properties of 2-anthracen-9-yl-N,N-dimethylethanethioamide?
2-anthracen-9-yl-N,N-dimethylethanethioamide has a molecular weight of 279.41 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anthracen-9-yl-N,N-dimethylethanethioamide is sourced from PubChem (CID 58704033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).