C28H18N4OPt — CID 58704203
6-(1,3-benzoxazol-2-yl)-N-phenyl-N-[3-(2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) (PubChem CID 58704203) has the molecular formula C28H18N4OPt and a molecular weight of 621.56 g/mol. Its IUPAC name is 6-(1,3-benzoxazol-2-yl)-N-phenyl-N-[3-(2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+).
| Compound Name | 6-(1,3-benzoxazol-2-yl)-N-phenyl-N-[3-(2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 58704203 |
| Molecular Formula | C28H18N4OPt |
| Molecular Weight | 621.56 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | 6-(1,3-benzoxazol-2-yl)-N-phenyl-N-[3-(2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]pyridin-2-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(N(c2ccccc2)c2cccc(-c3nc4ccccc4o3)n2)cccc1-n1[c-]ccc1 |
| InChI | InChI=1S/C28H18N4O.Pt/c1-2-10-21(11-3-1)32(23-13-8-12-22(20-23)31-18-6-7-19-31)27-17-9-15-25(29-27)28-30-24-14-4-5-16-26(24)33-28;/h1-18H;/q-2;+2 |
| InChIKey | LBZXSXRYQFFHTK-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|