About diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+)
diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) (PubChem CID 58704230) has the molecular formula C30H22N4PtSi
and a molecular weight of 661.70 g/mol. Its IUPAC name is diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+).
Molecular Properties
| Compound Name | diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) |
| PubChem CID | 58704230 |
| Molecular Formula | C30H22N4PtSi |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.13 |
| IUPAC Name | diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-n2cccn2)cccc1[Si](c1[c-]c(-n2cccn2)ccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22N4Si.Pt/c1-3-13-27(14-4-1)35(28-15-5-2-6-16-28,29-17-7-11-25(23-29)33-21-9-19-31-33)30-18-8-12-26(24-30)34-22-10-20-32-34;/h1-22H;/q-2;+2 |
| InChIKey | RHXWYDAEYRLEKE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+)?
The IUPAC name of diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) (CID 58704230) is diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+).
What is the SMILES notation for diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+)?
The canonical SMILES for diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) is [Pt+2].[c-]1c(-n2cccn2)cccc1[Si](c1[c-]c(-n2cccn2)ccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+)?
The InChIKey is RHXWYDAEYRLEKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H22N4Si.Pt/c1-3-13-27(14-4-1)35(28-15-5-2-6-16-28,29-17-7-11-25(23-29)33-21-9-19-31-33)30-18-8-12-26(24-30)34-22-10-20-32-34;/h1-22H;/q-2;+2.
What are the key properties of diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+)?
diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) has a molecular weight of 661.70 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)silane;platinum(2+) is sourced from PubChem (CID 58704230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).