C29H16F6N4Pt — CID 58704393
2-[3-[1,1,1,3,3,3-hexafluoro-2-(3-indazol-2-ylbenzene-2-id-1-yl)propan-2-yl]benzene-2-id-1-yl]indazole;platinum(2+) (PubChem CID 58704393) has the molecular formula C29H16F6N4Pt and a molecular weight of 729.54 g/mol. Its IUPAC name is 2-[3-[1,1,1,3,3,3-hexafluoro-2-(3-indazol-2-ylbenzene-2-id-1-yl)propan-2-yl]benzene-2-id-1-yl]indazole;platinum(2+).
| Compound Name | 2-[3-[1,1,1,3,3,3-hexafluoro-2-(3-indazol-2-ylbenzene-2-id-1-yl)propan-2-yl]benzene-2-id-1-yl]indazole;platinum(2+) |
|---|---|
| PubChem CID | 58704393 |
| Molecular Formula | C29H16F6N4Pt |
| Molecular Weight | 729.54 g/mol |
| Exact Mass | 729.09 |
| IUPAC Name | 2-[3-[1,1,1,3,3,3-hexafluoro-2-(3-indazol-2-ylbenzene-2-id-1-yl)propan-2-yl]benzene-2-id-1-yl]indazole;platinum(2+) |
| SMILES | FC(F)(F)C(c1[c-]c(-n2cc3ccccc3n2)ccc1)(c1[c-]c(-n2cc3ccccc3n2)ccc1)C(F)(F)F.[Pt+2] |
| InChI | InChI=1S/C29H16F6N4.Pt/c30-28(31,32)27(29(33,34)35,21-9-5-11-23(15-21)38-17-19-7-1-3-13-25(19)36-38)22-10-6-12-24(16-22)39-18-20-8-2-4-14-26(20)37-39;/h1-14,17-18H;/q-2;+2 |
| InChIKey | FJPQHWXMSNCGBL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.54 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|