About 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+)
2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) (PubChem CID 58704401) has the molecular formula C22H12N6Pt
and a molecular weight of 555.46 g/mol. Its IUPAC name is 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+).
Molecular Properties
| Compound Name | 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) |
| PubChem CID | 58704401 |
| Molecular Formula | C22H12N6Pt |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) |
| SMILES | [C-]#[N+]C(C#N)=C(c1[c-]c(-n2cccn2)ccc1)c1[c-]c(-n2cccn2)ccc1.[Pt+2] |
| InChI | InChI=1S/C22H12N6.Pt/c1-24-21(16-23)22(17-6-2-8-19(14-17)27-12-4-10-25-27)18-7-3-9-20(15-18)28-13-5-11-26-28;/h2-13H;/q-2;+2 |
| InChIKey | GOKNQHUTYOZFDX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+)?
The IUPAC name of 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) (CID 58704401) is 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+).
What is the SMILES notation for 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+)?
The canonical SMILES for 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) is [C-]#[N+]C(C#N)=C(c1[c-]c(-n2cccn2)ccc1)c1[c-]c(-n2cccn2)ccc1.[Pt+2].
What is the InChIKey of 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+)?
The InChIKey is GOKNQHUTYOZFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12N6.Pt/c1-24-21(16-23)22(17-6-2-8-19(14-17)27-12-4-10-25-27)18-7-3-9-20(15-18)28-13-5-11-26-28;/h2-13H;/q-2;+2.
What are the key properties of 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+)?
2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) has a molecular weight of 555.46 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyano-3,3-bis(3-pyrazol-1-ylbenzene-2-id-1-yl)prop-2-enenitrile;platinum(2+) is sourced from PubChem (CID 58704401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).