About 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol
2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol (PubChem CID 58704461) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol |
| PubChem CID | 58704461 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(-n2nc3ccc(N)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H26N4O/c1-19(2,3)12-9-14(20(4,5)6)18(25)17(10-12)24-22-15-8-7-13(21)11-16(15)23-24/h7-11,25H,21H2,1-6H3 |
| InChIKey | FCQLCYLEEMWNMA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol?
The IUPAC name of 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol (CID 58704461) is 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol.
What is the SMILES notation for 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol?
The canonical SMILES for 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol is CC(C)(C)c1cc(-n2nc3ccc(N)cc3n2)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol?
The InChIKey is FCQLCYLEEMWNMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O/c1-19(2,3)12-9-14(20(4,5)6)18(25)17(10-12)24-22-15-8-7-13(21)11-16(15)23-24/h7-11,25H,21H2,1-6H3.
What are the key properties of 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol?
2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol has a molecular weight of 338.46 g/mol, XLogP of 4.30, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-aminobenzotriazol-2-yl)-4,6-ditert-butylphenol is sourced from PubChem (CID 58704461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).