C19H14F4N6 — CID 58704813
1-(2,4-difluorophenyl)-3-[2-[1-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]propan-2-yl]-1,2,4-triazole (PubChem CID 58704813) has the molecular formula C19H14F4N6 and a molecular weight of 402.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[2-[1-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]propan-2-yl]-1,2,4-triazole.
| Compound Name | 1-(2,4-difluorophenyl)-3-[2-[1-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]propan-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 58704813 |
| Molecular Formula | C19H14F4N6 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[2-[1-(2,4-difluorophenyl)-1,2,4-triazol-3-yl]propan-2-yl]-1,2,4-triazole |
| SMILES | CC(C)(c1ncn(-c2ccc(F)cc2F)n1)c1ncn(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C19H14F4N6/c1-19(2,17-24-9-28(26-17)15-5-3-11(20)7-13(15)22)18-25-10-29(27-18)16-6-4-12(21)8-14(16)23/h3-10H,1-2H3 |
| InChIKey | AAZHPWZNDPILOG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |