C7H11N3 — CID 58706072
1,2,4-trimethyl-6-methylidene-1,3,5-triazine (PubChem CID 58706072) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 1,2,4-trimethyl-6-methylidene-1,3,5-triazine.
| Compound Name | 1,2,4-trimethyl-6-methylidene-1,3,5-triazine |
|---|---|
| PubChem CID | 58706072 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 1,2,4-trimethyl-6-methylidene-1,3,5-triazine |
| SMILES | C=C1N=C(C)N=C(C)N1C |
| InChI | InChI=1S/C7H11N3/c1-5-8-6(2)10(4)7(3)9-5/h2H2,1,3-4H3 |
| InChIKey | KYOJQAMUUNIOKN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |