C37H33F5N2O9S — CID 58706411
diethyl 2-[[3-(dimethylcarbamoyl)-2,6-difluoro-4-[[2-methyl-6-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenoxy]carbonyloxymethyl]-2-thiophen-2-ylpropanedioate (PubChem CID 58706411) has the molecular formula C37H33F5N2O9S and a molecular weight of 776.73 g/mol. Its IUPAC name is diethyl 2-[[3-(dimethylcarbamoyl)-2,6-difluoro-4-[[2-methyl-6-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenoxy]carbonyloxymethyl]-2-thiophen-2-ylpropanedioate.
| Compound Name | diethyl 2-[[3-(dimethylcarbamoyl)-2,6-difluoro-4-[[2-methyl-6-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenoxy]carbonyloxymethyl]-2-thiophen-2-ylpropanedioate |
|---|---|
| PubChem CID | 58706411 |
| Molecular Formula | C37H33F5N2O9S |
| Molecular Weight | 776.73 g/mol |
| Exact Mass | 776.18 |
| IUPAC Name | diethyl 2-[[3-(dimethylcarbamoyl)-2,6-difluoro-4-[[2-methyl-6-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenoxy]carbonyloxymethyl]-2-thiophen-2-ylpropanedioate |
| SMILES | CCOC(=O)C(COC(=O)Oc1c(F)cc(NC(=O)c2c(C)cccc2-c2ccc(C(F)(F)F)cc2)c(C(=O)N(C)C)c1F)(C(=O)OCC)c1cccs1 |
| InChI | InChI=1S/C37H33F5N2O9S/c1-6-50-33(47)36(34(48)51-7-2,26-12-9-17-54-26)19-52-35(49)53-30-24(38)18-25(28(29(30)39)32(46)44(4)5)43-31(45)27-20(3)10-8-11-23(27)21-13-15-22(16-14-21)37(40,41)42/h8-18H,6-7,19H2,1-5H3,(H,43,45) |
| InChIKey | DOCBLFQUQLUKJY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|