C19H21N5O2S — CID 58706823
5-[[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid (PubChem CID 58706823) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 5-[[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid.
| Compound Name | 5-[[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid |
|---|---|
| PubChem CID | 58706823 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-[[5-[6-[(4-methyl-2-pyridinyl)amino]-2-pyridinyl]-1,3-thiazol-2-yl]amino]pentanoic acid |
| SMILES | Cc1ccnc(Nc2cccc(-c3cnc(NCCCCC(=O)O)s3)n2)c1 |
| InChI | InChI=1S/C19H21N5O2S/c1-13-8-10-20-17(11-13)24-16-6-4-5-14(23-16)15-12-22-19(27-15)21-9-3-2-7-18(25)26/h4-6,8,10-12H,2-3,7,9H2,1H3,(H,21,22)(H,25,26)(H,20,23,24) |
| InChIKey | NNLWCLCUNUUUTF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|