About (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone
(3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone (PubChem CID 58707365) has the molecular formula C21H22FN3OS
and a molecular weight of 383.49 g/mol. Its IUPAC name is (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone.
Molecular Properties
| Compound Name | (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone |
| PubChem CID | 58707365 |
| Molecular Formula | C21H22FN3OS |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone |
| SMILES | Cc1cc2c(N)c(C(=O)c3cc(F)ccc3N3CCCCC3)sc2nc1C |
| InChI | InChI=1S/C21H22FN3OS/c1-12-10-16-18(23)20(27-21(16)24-13(12)2)19(26)15-11-14(22)6-7-17(15)25-8-4-3-5-9-25/h6-7,10-11H,3-5,8-9,23H2,1-2H3 |
| InChIKey | PYOBMACLUNNIBK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone?
The IUPAC name of (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone (CID 58707365) is (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone.
What is the SMILES notation for (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone?
The canonical SMILES for (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone is Cc1cc2c(N)c(C(=O)c3cc(F)ccc3N3CCCCC3)sc2nc1C.
What is the InChIKey of (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone?
The InChIKey is PYOBMACLUNNIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3OS/c1-12-10-16-18(23)20(27-21(16)24-13(12)2)19(26)15-11-14(22)6-7-17(15)25-8-4-3-5-9-25/h6-7,10-11H,3-5,8-9,23H2,1-2H3.
What are the key properties of (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone?
(3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone has a molecular weight of 383.49 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-5,6-dimethylthieno[2,3-b]pyridin-2-yl)-(5-fluoro-2-piperidin-1-ylphenyl)methanone is sourced from PubChem (CID 58707365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).