C16H32N2 — CID 58707395
4-N-tert-butyl-1-N-cyclohexylcyclohexane-1,4-diamine (PubChem CID 58707395) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-cyclohexylcyclohexane-1,4-diamine.
| Compound Name | 4-N-tert-butyl-1-N-cyclohexylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 58707395 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 4-N-tert-butyl-1-N-cyclohexylcyclohexane-1,4-diamine |
| SMILES | CC(C)(C)NC1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C16H32N2/c1-16(2,3)18-15-11-9-14(10-12-15)17-13-7-5-4-6-8-13/h13-15,17-18H,4-12H2,1-3H3 |
| InChIKey | ZHFMWEBBMZMKEL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |