C9H15NO6P2 — CID 58708679
[6-[[hydroxy(methoxy)phosphoryl]methyl]-2-pyridinyl]methyl-methoxyphosphinic acid (PubChem CID 58708679) has the molecular formula C9H15NO6P2 and a molecular weight of 295.17 g/mol. Its IUPAC name is [6-[[hydroxy(methoxy)phosphoryl]methyl]-2-pyridinyl]methyl-methoxyphosphinic acid.
| Compound Name | [6-[[hydroxy(methoxy)phosphoryl]methyl]-2-pyridinyl]methyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 58708679 |
| Molecular Formula | C9H15NO6P2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | [6-[[hydroxy(methoxy)phosphoryl]methyl]-2-pyridinyl]methyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)Cc1cccc(CP(=O)(O)OC)n1 |
| InChI | InChI=1S/C9H15NO6P2/c1-15-17(11,12)6-8-4-3-5-9(10-8)7-18(13,14)16-2/h3-5H,6-7H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | GTYUDMRGTVSERK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 105.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|