About 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride
4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride (PubChem CID 58708780) has the molecular formula C21H21F3O2
and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride.
Molecular Properties
| Compound Name | 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride |
| PubChem CID | 58708780 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride |
| SMILES | Cc1cc(C2CCC(C)CO2)cc(C)c1-c1cc(F)c(C(=O)F)c(F)c1 |
| InChI | InChI=1S/C21H21F3O2/c1-11-4-5-18(26-10-11)14-6-12(2)19(13(3)7-14)15-8-16(22)20(21(24)25)17(23)9-15/h6-9,11,18H,4-5,10H2,1-3H3 |
| InChIKey | UZLPYELWSWODJH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride?
The IUPAC name of 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride (CID 58708780) is 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride.
What is the SMILES notation for 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride?
The canonical SMILES for 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride is Cc1cc(C2CCC(C)CO2)cc(C)c1-c1cc(F)c(C(=O)F)c(F)c1.
What is the InChIKey of 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride?
The InChIKey is UZLPYELWSWODJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3O2/c1-11-4-5-18(26-10-11)14-6-12(2)19(13(3)7-14)15-8-16(22)20(21(24)25)17(23)9-15/h6-9,11,18H,4-5,10H2,1-3H3.
What are the key properties of 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride?
4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride has a molecular weight of 362.39 g/mol, XLogP of 5.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-dimethyl-4-(5-methyloxan-2-yl)phenyl]-2,6-difluorobenzoyl fluoride is sourced from PubChem (CID 58708780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).