About platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid
platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 58709017) has the molecular formula C19H15N2O2Pt-
and a molecular weight of 498.42 g/mol. Its IUPAC name is platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid |
| PubChem CID | 58709017 |
| Molecular Formula | C19H15N2O2Pt- |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(Cc2[c-]c(Cc3ccccn3)ccc2)n1.[Pt] |
| InChI | InChI=1S/C19H15N2O2.Pt/c22-19(23)18-9-4-8-17(21-18)13-15-6-3-5-14(11-15)12-16-7-1-2-10-20-16;/h1-10H,12-13H2,(H,22,23);/q-1; |
| InChIKey | BHMUOFSIXVEWNG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid?
The IUPAC name of platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid (CID 58709017) is platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid?
The canonical SMILES for platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid is O=C(O)c1cccc(Cc2[c-]c(Cc3ccccn3)ccc2)n1.[Pt].
What is the InChIKey of platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid?
The InChIKey is BHMUOFSIXVEWNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N2O2.Pt/c22-19(23)18-9-4-8-17(21-18)13-15-6-3-5-14(11-15)12-16-7-1-2-10-20-16;/h1-10H,12-13H2,(H,22,23);/q-1;.
What are the key properties of platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid?
platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid has a molecular weight of 498.42 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;6-[[3-(pyridin-2-ylmethyl)benzene-2-id-1-yl]methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 58709017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).