C34H40N7O4+ — CID 58709396
methyl 4-[[4-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylate (PubChem CID 58709396) has the molecular formula C34H40N7O4+ and a molecular weight of 610.74 g/mol. Its IUPAC name is methyl 4-[[4-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 4-[[4-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 58709396 |
| Molecular Formula | C34H40N7O4+ |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | methyl 4-[[4-[4-[3,6-bis(dimethylamino)acridin-10-ium-10-yl]butanoylamino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc(NC(=O)CCC[n+]3c4cc(N(C)C)ccc4cc4ccc(N(C)C)cc43)cn2C)cn1C |
| InChI | InChI=1S/C34H39N7O4/c1-37(2)26-12-10-22-15-23-11-13-27(38(3)4)19-29(23)41(28(22)18-26)14-8-9-32(42)35-24-16-30(39(5)20-24)33(43)36-25-17-31(34(44)45-7)40(6)21-25/h10-13,15-21H,8-9,14H2,1-7H3,(H-,35,36,42,43)/p+1 |
| InChIKey | OHGOSAQUPXZOEU-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|