C18H29NO — CID 58709449
2-(2-methylphenyl)-N-(2,2,4-trimethylhexan-3-yl)acetamide (PubChem CID 58709449) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2-(2-methylphenyl)-N-(2,2,4-trimethylhexan-3-yl)acetamide.
| Compound Name | 2-(2-methylphenyl)-N-(2,2,4-trimethylhexan-3-yl)acetamide |
|---|---|
| PubChem CID | 58709449 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2-(2-methylphenyl)-N-(2,2,4-trimethylhexan-3-yl)acetamide |
| SMILES | CCC(C)C(NC(=O)Cc1ccccc1C)C(C)(C)C |
| InChI | InChI=1S/C18H29NO/c1-7-13(2)17(18(4,5)6)19-16(20)12-15-11-9-8-10-14(15)3/h8-11,13,17H,7,12H2,1-6H3,(H,19,20) |
| InChIKey | YTWZLCNYOKVNTA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |