C13H17BN4O — CID 58710046
methyl-[4-(4-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)-3,6-dihydro-2H-pyridin-1-yl]borinic acid (PubChem CID 58710046) has the molecular formula C13H17BN4O and a molecular weight of 256.12 g/mol. Its IUPAC name is methyl-[4-(4-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)-3,6-dihydro-2H-pyridin-1-yl]borinic acid.
| Compound Name | methyl-[4-(4-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)-3,6-dihydro-2H-pyridin-1-yl]borinic acid |
|---|---|
| PubChem CID | 58710046 |
| Molecular Formula | C13H17BN4O |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | methyl-[4-(4-methyl-7H-pyrrolo[2,3-d]pyrimidin-6-yl)-3,6-dihydro-2H-pyridin-1-yl]borinic acid |
| SMILES | CB(O)N1CC=C(c2cc3c(C)ncnc3[nH]2)CC1 |
| InChI | InChI=1S/C13H17BN4O/c1-9-11-7-12(17-13(11)16-8-15-9)10-3-5-18(6-4-10)14(2)19/h3,7-8,19H,4-6H2,1-2H3,(H,15,16,17) |
| InChIKey | MVNANWJRWSENBH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|