About 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one
5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one (PubChem CID 58710081) has the molecular formula C8H5N3O3S
and a molecular weight of 223.21 g/mol. Its IUPAC name is 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one |
| PubChem CID | 58710081 |
| Molecular Formula | C8H5N3O3S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc([N+](=O)[O-])cc1-c1cncs1 |
| InChI | InChI=1S/C8H5N3O3S/c12-8-6(7-3-9-4-15-7)1-5(2-10-8)11(13)14/h1-4H,(H,10,12) |
| InChIKey | UINXFDDATSZTGY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one?
The IUPAC name of 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one (CID 58710081) is 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one.
What is the SMILES notation for 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one?
The canonical SMILES for 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one is O=c1[nH]cc([N+](=O)[O-])cc1-c1cncs1.
What is the InChIKey of 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one?
The InChIKey is UINXFDDATSZTGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O3S/c12-8-6(7-3-9-4-15-7)1-5(2-10-8)11(13)14/h1-4H,(H,10,12).
What are the key properties of 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one?
5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one has a molecular weight of 223.21 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-3-(1,3-thiazol-5-yl)-1H-pyridin-2-one is sourced from PubChem (CID 58710081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).