C20H23N3O4 — CID 58710096
N-(2-methoxyethyl)-6-[(E)-3-oxo-3-(1,4,5-trimethyl-2-oxo-3-pyridinyl)prop-1-enyl]pyridine-2-carboxamide (PubChem CID 58710096) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[(E)-3-oxo-3-(1,4,5-trimethyl-2-oxo-3-pyridinyl)prop-1-enyl]pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-[(E)-3-oxo-3-(1,4,5-trimethyl-2-oxo-3-pyridinyl)prop-1-enyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58710096 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-(2-methoxyethyl)-6-[(E)-3-oxo-3-(1,4,5-trimethyl-2-oxo-3-pyridinyl)prop-1-enyl]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cccc(/C=C/C(=O)c2c(C)c(C)cn(C)c2=O)n1 |
| InChI | InChI=1S/C20H23N3O4/c1-13-12-23(3)20(26)18(14(13)2)17(24)9-8-15-6-5-7-16(22-15)19(25)21-10-11-27-4/h5-9,12H,10-11H2,1-4H3,(H,21,25)/b9-8+ |
| InChIKey | WACHAUAOZZBTEU-CMDGGOBGSA-N |
| XLogP | 1.67 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|