About 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum
5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum (PubChem CID 58710113) has the molecular formula C17H22LaNO2-
and a molecular weight of 411.27 g/mol. Its IUPAC name is 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum.
Molecular Properties
| Compound Name | 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum |
| PubChem CID | 58710113 |
| Molecular Formula | C17H22LaNO2- |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum |
| SMILES | Cc1[c-]n(C)c(=O)c(C(=O)/C=C/C2CCCCC2)c1C.[La] |
| InChI | InChI=1S/C17H22NO2.La/c1-12-11-18(3)17(20)16(13(12)2)15(19)10-9-14-7-5-4-6-8-14;/h9-10,14H,4-8H2,1-3H3;/q-1;/b10-9+; |
| InChIKey | PYYRFLLGRZMNEP-RRABGKBLSA-N |
| XLogP | 3.12 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum?
The IUPAC name of 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum (CID 58710113) is 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum.
What is the SMILES notation for 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum?
The canonical SMILES for 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum is Cc1[c-]n(C)c(=O)c(C(=O)/C=C/C2CCCCC2)c1C.[La].
What is the InChIKey of 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum?
The InChIKey is PYYRFLLGRZMNEP-RRABGKBLSA-N. The full InChI is InChI=1S/C17H22NO2.La/c1-12-11-18(3)17(20)16(13(12)2)15(19)10-9-14-7-5-4-6-8-14;/h9-10,14H,4-8H2,1-3H3;/q-1;/b10-9+;.
What are the key properties of 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum?
5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum has a molecular weight of 411.27 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-3-cyclohexylprop-2-enoyl]-1,3,4-trimethyl-2H-pyridin-2-id-6-one;lanthanum is sourced from PubChem (CID 58710113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).