About 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum
3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum (PubChem CID 58710132) has the molecular formula C17H22NO2Ta-
and a molecular weight of 453.32 g/mol. Its IUPAC name is 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum.
Molecular Properties
| Compound Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum |
| PubChem CID | 58710132 |
| Molecular Formula | C17H22NO2Ta- |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum |
| SMILES | Cc1[n-]c(=O)c(C(=O)/C=C/C2CCCCC2)c(C)c1C.[Ta] |
| InChI | InChI=1S/C17H23NO2.Ta/c1-11-12(2)16(17(20)18-13(11)3)15(19)10-9-14-7-5-4-6-8-14;/h9-10,14H,4-8H2,1-3H3,(H,18,19,20);/p-1/b10-9+; |
| InChIKey | VTNVBTOWOHLZIO-RRABGKBLSA-M |
| XLogP | 3.25 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum?
The IUPAC name of 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum (CID 58710132) is 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum.
What is the SMILES notation for 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum?
The canonical SMILES for 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum is Cc1[n-]c(=O)c(C(=O)/C=C/C2CCCCC2)c(C)c1C.[Ta].
What is the InChIKey of 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum?
The InChIKey is VTNVBTOWOHLZIO-RRABGKBLSA-M. The full InChI is InChI=1S/C17H23NO2.Ta/c1-11-12(2)16(17(20)18-13(11)3)15(19)10-9-14-7-5-4-6-8-14;/h9-10,14H,4-8H2,1-3H3,(H,18,19,20);/p-1/b10-9+;.
What are the key properties of 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum?
3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum has a molecular weight of 453.32 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-cyclohexylprop-2-enoyl]-4,5,6-trimethylpyridin-1-id-2-one;tantalum is sourced from PubChem (CID 58710132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).