C18H25NO2 — CID 58710135
3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one (PubChem CID 58710135) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one.
| Compound Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one |
|---|---|
| PubChem CID | 58710135 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-[(E)-3-cyclohexylprop-2-enoyl]-1,4,5,6-tetramethylpyridin-2-one |
| SMILES | Cc1c(C)c(C)n(C)c(=O)c1C(=O)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C18H25NO2/c1-12-13(2)17(18(21)19(4)14(12)3)16(20)11-10-15-8-6-5-7-9-15/h10-11,15H,5-9H2,1-4H3/b11-10+ |
| InChIKey | IILSDBGNHSVEJQ-ZHACJKMWSA-N |
| XLogP | 3.63 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|