About 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one
4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 58710516) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 58710516 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCc1ncnc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C12H15N3O/c1-2-3-4-5-10-9-6-7-11(16)15-12(9)14-8-13-10/h6-8H,2-5H2,1H3,(H,13,14,15,16) |
| InChIKey | AQJUOQGGPCDZFW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one (CID 58710516) is 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one is CCCCCc1ncnc2[nH]c(=O)ccc12.
What is the InChIKey of 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is AQJUOQGGPCDZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-2-3-4-5-10-9-6-7-11(16)15-12(9)14-8-13-10/h6-8H,2-5H2,1H3,(H,13,14,15,16).
What are the key properties of 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one?
4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 217.27 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyl-8H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 58710516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).