C32H54O3 — CID 58711001
[5-hydroxy-3-propan-2-yl-6-[(9S,10S,13S)-9,10,13-trimethyl-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]heptyl] acetate (PubChem CID 58711001) has the molecular formula C32H54O3 and a molecular weight of 486.78 g/mol. Its IUPAC name is [5-hydroxy-3-propan-2-yl-6-[(9S,10S,13S)-9,10,13-trimethyl-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]heptyl] acetate.
| Compound Name | [5-hydroxy-3-propan-2-yl-6-[(9S,10S,13S)-9,10,13-trimethyl-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]heptyl] acetate |
|---|---|
| PubChem CID | 58711001 |
| Molecular Formula | C32H54O3 |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | [5-hydroxy-3-propan-2-yl-6-[(9S,10S,13S)-9,10,13-trimethyl-1,2,3,4,5,6,7,8,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]heptyl] acetate |
| SMILES | CC(=O)OCCC(CC(O)C(C)C1=CCC2C3CCC4CCCC[C@]4(C)[C@@]3(C)CC[C@]12C)C(C)C |
| InChI | InChI=1S/C32H54O3/c1-21(2)24(15-19-35-23(4)33)20-29(34)22(3)26-13-14-27-28-12-11-25-10-8-9-16-31(25,6)32(28,7)18-17-30(26,27)5/h13,21-22,24-25,27-29,34H,8-12,14-20H2,1-7H3/t22?,24?,25?,27?,28?,29?,30-,31+,32+/m1/s1 |
| InChIKey | SWHPNJZUGHOKHD-XXZYDMBASA-N |
| XLogP | 7.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|