C56H68B2O6 — CID 58711224
2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-[9,9-bis(2-methylbutyl)fluoren-2-yl]-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane (PubChem CID 58711224) has the molecular formula C56H68B2O6 and a molecular weight of 858.78 g/mol. Its IUPAC name is 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-[9,9-bis(2-methylbutyl)fluoren-2-yl]-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-[9,9-bis(2-methylbutyl)fluoren-2-yl]-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58711224 |
| Molecular Formula | C56H68B2O6 |
| Molecular Weight | 858.78 g/mol |
| Exact Mass | 858.52 |
| IUPAC Name | 2-[9-[3,4-bis(2-methylbutoxy)phenyl]-9-[9,9-bis(2-methylbutyl)fluoren-2-yl]-7-(1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCC(C)COc1ccc(C2(c3ccc4c(c3)C(CC(C)CC)(CC(C)CC)c3ccccc3-4)c3cc(B4OCCO4)ccc3-c3ccc(B4OCCO4)cc32)cc1OCC(C)CC |
| InChI | InChI=1S/C56H68B2O6/c1-9-37(5)33-55(34-38(6)10-2)49-16-14-13-15-45(49)46-21-17-41(29-50(46)55)56(42-18-24-53(59-35-39(7)11-3)54(30-42)60-36-40(8)12-4)51-31-43(57-61-25-26-62-57)19-22-47(51)48-23-20-44(32-52(48)56)58-63-27-28-64-58/h13-24,29-32,37-40H,9-12,25-28,33-36H2,1-8H3 |
| InChIKey | YKWQGSCOSJPYRT-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.78 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|