C39H28O16S4 — CID 58711231
5-[4-[bis(4-hydroxyphenyl)-[4-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]methyl]benzoyl]benzene-1,3-disulfonic acid (PubChem CID 58711231) has the molecular formula C39H28O16S4 and a molecular weight of 880.91 g/mol. Its IUPAC name is 5-[4-[bis(4-hydroxyphenyl)-[4-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]methyl]benzoyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[4-[bis(4-hydroxyphenyl)-[4-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]methyl]benzoyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 58711231 |
| Molecular Formula | C39H28O16S4 |
| Molecular Weight | 880.91 g/mol |
| Exact Mass | 880.03 |
| IUPAC Name | 5-[4-[bis(4-hydroxyphenyl)-[4-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]methyl]benzoyl]benzene-1,3-disulfonic acid |
| SMILES | O=C(c1ccc(C(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccc(C(=O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3)cc2)cc1)c1cc(SOOO)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C39H28O16S4/c40-31-13-9-29(10-14-31)39(30-11-15-32(41)16-12-30,27-5-1-23(2-6-27)37(42)25-17-33(56-55-54-44)21-34(18-25)57(45,46)47)28-7-3-24(4-8-28)38(43)26-19-35(58(48,49)50)22-36(20-26)59(51,52)53/h1-22,40-41,44H,(H,45,46,47)(H,48,49,50)(H,51,52,53) |
| InChIKey | SGHAKLNGLMTSQN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 276.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|