C29H18F6O16S4 — CID 58711248
3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]propan-2-yl]-2-hydroxybenzoyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 58711248) has the molecular formula C29H18F6O16S4 and a molecular weight of 864.70 g/mol. Its IUPAC name is 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]propan-2-yl]-2-hydroxybenzoyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]propan-2-yl]-2-hydroxybenzoyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58711248 |
| Molecular Formula | C29H18F6O16S4 |
| Molecular Weight | 864.70 g/mol |
| Exact Mass | 863.94 |
| IUPAC Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[3-sulfo-5-(trioxidanylsulfanyl)benzoyl]phenyl]propan-2-yl]-2-hydroxybenzoyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | O=C(c1cc(SOOO)cc(S(=O)(=O)O)c1)c1cc(C(c2ccc(O)c(C(=O)c3cc(SOOO)cc(S(=O)(=O)O)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1O |
| InChI | InChI=1S/C29H18F6O16S4/c30-28(31,32)27(29(33,34)35,15-1-3-23(36)21(9-15)25(38)13-5-17(52-50-48-40)11-19(7-13)54(42,43)44)16-2-4-24(37)22(10-16)26(39)14-6-18(53-51-49-41)12-20(8-14)55(45,46)47/h1-12,36-37,40-41H,(H,42,43,44)(H,45,46,47) |
| InChIKey | APRLUJNYDODWAL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 260.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|