C27H22O9S2 — CID 58711283
5-[4-[1,1-bis(4-hydroxyphenyl)ethyl]benzoyl]benzene-1,3-disulfonic acid (PubChem CID 58711283) has the molecular formula C27H22O9S2 and a molecular weight of 554.60 g/mol. Its IUPAC name is 5-[4-[1,1-bis(4-hydroxyphenyl)ethyl]benzoyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[4-[1,1-bis(4-hydroxyphenyl)ethyl]benzoyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 58711283 |
| Molecular Formula | C27H22O9S2 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 5-[4-[1,1-bis(4-hydroxyphenyl)ethyl]benzoyl]benzene-1,3-disulfonic acid |
| SMILES | CC(c1ccc(O)cc1)(c1ccc(O)cc1)c1ccc(C(=O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H22O9S2/c1-27(20-6-10-22(28)11-7-20,21-8-12-23(29)13-9-21)19-4-2-17(3-5-19)26(30)18-14-24(37(31,32)33)16-25(15-18)38(34,35)36/h2-16,28-29H,1H3,(H,31,32,33)(H,34,35,36) |
| InChIKey | AXIMNQFBVMYXGY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|