About 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid
5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid (PubChem CID 58711287) has the molecular formula C26H20O9S2
and a molecular weight of 540.57 g/mol. Its IUPAC name is 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid |
| PubChem CID | 58711287 |
| Molecular Formula | C26H20O9S2 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid |
| SMILES | O=C(c1ccc(C(c2ccc(O)cc2)c2ccc(O)cc2)cc1)c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C26H20O9S2/c27-21-9-5-17(6-10-21)25(18-7-11-22(28)12-8-18)16-1-3-19(4-2-16)26(29)20-13-23(36(30,31)32)15-24(14-20)37(33,34)35/h1-15,25,27-28H,(H,30,31,32)(H,33,34,35) |
| InChIKey | RDCNRMHNRWIUGV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid?
The IUPAC name of 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid (CID 58711287) is 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid.
What is the SMILES notation for 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid?
The canonical SMILES for 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid is O=C(c1ccc(C(c2ccc(O)cc2)c2ccc(O)cc2)cc1)c1cc(S(=O)(=O)O)cc(S(=O)(=O)O)c1.
What is the InChIKey of 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid?
The InChIKey is RDCNRMHNRWIUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20O9S2/c27-21-9-5-17(6-10-21)25(18-7-11-22(28)12-8-18)16-1-3-19(4-2-16)26(29)20-13-23(36(30,31)32)15-24(14-20)37(33,34)35/h1-15,25,27-28H,(H,30,31,32)(H,33,34,35).
What are the key properties of 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid?
5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid has a molecular weight of 540.57 g/mol, XLogP of 4.00, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[bis(4-hydroxyphenyl)methyl]benzoyl]benzene-1,3-disulfonic acid is sourced from PubChem (CID 58711287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).