C39H30O4 — CID 58711403
2-[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enyl]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 58711403) has the molecular formula C39H30O4 and a molecular weight of 562.67 g/mol. Its IUPAC name is 2-[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enyl]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enyl]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 58711403 |
| Molecular Formula | C39H30O4 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enyl]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC1(C)CC(/C=C/C2=C(O)c3cc4ccccc4cc3C2=O)=C/C(=C/C=C/C2C(=O)c3cc4ccccc4cc3C2=O)C1 |
| InChI | InChI=1S/C39H30O4/c1-39(2)21-23(8-7-13-29-35(40)31-17-25-9-3-4-10-26(25)18-32(31)36(29)41)16-24(22-39)14-15-30-37(42)33-19-27-11-5-6-12-28(27)20-34(33)38(30)43/h3-20,29,42H,21-22H2,1-2H3/b13-7+,15-14+,23-8- |
| InChIKey | JZFVFQCJHCCODM-NUKCTMGVSA-N |
| XLogP | 8.94 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|