C26H20N2O3 — CID 58711512
3-(1,3-benzoxazol-2-yl)-9-methyl-6-phenyl-7,8-dihydro-6H-pyrano[3,2-g]quinolin-2-one (PubChem CID 58711512) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-9-methyl-6-phenyl-7,8-dihydro-6H-pyrano[3,2-g]quinolin-2-one.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-9-methyl-6-phenyl-7,8-dihydro-6H-pyrano[3,2-g]quinolin-2-one |
|---|---|
| PubChem CID | 58711512 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-9-methyl-6-phenyl-7,8-dihydro-6H-pyrano[3,2-g]quinolin-2-one |
| SMILES | CN1CCC(c2ccccc2)c2cc3cc(-c4nc5ccccc5o4)c(=O)oc3cc21 |
| InChI | InChI=1S/C26H20N2O3/c1-28-12-11-18(16-7-3-2-4-8-16)19-13-17-14-20(26(29)31-24(17)15-22(19)28)25-27-21-9-5-6-10-23(21)30-25/h2-10,13-15,18H,11-12H2,1H3 |
| InChIKey | ILEDQRVMMOSQFG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|