C18H18N2O4 — CID 58712172
4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline (PubChem CID 58712172) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline.
| Compound Name | 4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline |
|---|---|
| PubChem CID | 58712172 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-[5-(3,4,5-trimethoxyphenyl)-1,2-oxazol-4-yl]aniline |
| SMILES | COc1cc(-c2oncc2-c2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-21-15-8-12(9-16(22-2)18(15)23-3)17-14(10-20-24-17)11-4-6-13(19)7-5-11/h4-10H,19H2,1-3H3 |
| InChIKey | PAXXFIIUTFQFLL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|