C14H16N4OS — CID 58712528
5-[4-(dimethylamino)-3,5-dimethylanilino]-3-oxo-1,2-thiazole-4-carbonitrile (PubChem CID 58712528) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 5-[4-(dimethylamino)-3,5-dimethylanilino]-3-oxo-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-[4-(dimethylamino)-3,5-dimethylanilino]-3-oxo-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 58712528 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-[4-(dimethylamino)-3,5-dimethylanilino]-3-oxo-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1cc(Nc2s[nH]c(=O)c2C#N)cc(C)c1N(C)C |
| InChI | InChI=1S/C14H16N4OS/c1-8-5-10(6-9(2)12(8)18(3)4)16-14-11(7-15)13(19)17-20-14/h5-6,16H,1-4H3,(H,17,19) |
| InChIKey | YJURARQJKHCHMN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|