C22H33NO5 — CID 58712722
(3'aR,8'aS,9'S,9'aS)-1'-methyl-3'-oxo-N,N-di(propan-2-yl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide (PubChem CID 58712722) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is (3'aR,8'aS,9'S,9'aS)-1'-methyl-3'-oxo-N,N-di(propan-2-yl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide.
| Compound Name | (3'aR,8'aS,9'S,9'aS)-1'-methyl-3'-oxo-N,N-di(propan-2-yl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide |
|---|---|
| PubChem CID | 58712722 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (3'aR,8'aS,9'S,9'aS)-1'-methyl-3'-oxo-N,N-di(propan-2-yl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide |
| SMILES | CC1OC(=O)[C@@H]2C=C3CC4(CC[C@H]3[C@H](C(=O)N(C(C)C)C(C)C)[C@H]12)OCCO4 |
| InChI | InChI=1S/C22H33NO5/c1-12(2)23(13(3)4)20(24)19-16-6-7-22(26-8-9-27-22)11-15(16)10-17-18(19)14(5)28-21(17)25/h10,12-14,16-19H,6-9,11H2,1-5H3/t14?,16-,17-,18-,19+/m1/s1 |
| InChIKey | AMPPZFUGOKZUKA-CYCWSIQASA-N |
| XLogP | 2.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|