C23H28FNO5S3 — CID 58712930
1-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonyl-propylamino]butan-2-yl 4-methylbenzenesulfonate (PubChem CID 58712930) has the molecular formula C23H28FNO5S3 and a molecular weight of 513.68 g/mol. Its IUPAC name is 1-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonyl-propylamino]butan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 1-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonyl-propylamino]butan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58712930 |
| Molecular Formula | C23H28FNO5S3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 1-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)sulfonyl-propylamino]butan-2-yl 4-methylbenzenesulfonate |
| SMILES | CCCN(CC(CC)OS(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1sc2ccc(F)cc2c1C |
| InChI | InChI=1S/C23H28FNO5S3/c1-5-13-25(15-19(6-2)30-33(28,29)20-10-7-16(3)8-11-20)32(26,27)23-17(4)21-14-18(24)9-12-22(21)31-23/h7-12,14,19H,5-6,13,15H2,1-4H3 |
| InChIKey | SQKUJGRUIYOBPG-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|