C13H16FNO3S2 — CID 58713257
5-fluoro-N-(2-hydroxybutyl)-3-methyl-1-benzothiophene-2-sulfonamide (PubChem CID 58713257) has the molecular formula C13H16FNO3S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 5-fluoro-N-(2-hydroxybutyl)-3-methyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-fluoro-N-(2-hydroxybutyl)-3-methyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58713257 |
| Molecular Formula | C13H16FNO3S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-fluoro-N-(2-hydroxybutyl)-3-methyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCC(O)CNS(=O)(=O)c1sc2ccc(F)cc2c1C |
| InChI | InChI=1S/C13H16FNO3S2/c1-3-10(16)7-15-20(17,18)13-8(2)11-6-9(14)4-5-12(11)19-13/h4-6,10,15-16H,3,7H2,1-2H3 |
| InChIKey | DCSOSRSVROZYKR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |